C21H17Cl2F2NO — CID 3724836
2-[(2,4-dichlorophenyl)methylamino]-1,1-bis(4-fluorophenyl)ethanol (PubChem CID 3724836) has the molecular formula C21H17Cl2F2NO and a molecular weight of 408.28 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methylamino]-1,1-bis(4-fluorophenyl)ethanol.
| Compound Name | 2-[(2,4-dichlorophenyl)methylamino]-1,1-bis(4-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 3724836 |
| Molecular Formula | C21H17Cl2F2NO |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methylamino]-1,1-bis(4-fluorophenyl)ethanol |
| SMILES | OC(CNCc1ccc(Cl)cc1Cl)(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H17Cl2F2NO/c22-17-6-1-14(20(23)11-17)12-26-13-21(27,15-2-7-18(24)8-3-15)16-4-9-19(25)10-5-16/h1-11,26-27H,12-13H2 |
| InChIKey | QMTPFDCTDDBZNJ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |