C17H21ClN4O2S2 — CID 3727397
N-(2-chlorophenyl)-2-[4-(2-sulfanylidene-1,3-thiazolidine-4-carbonyl)-1,4-diazepan-1-yl]acetamide (PubChem CID 3727397) has the molecular formula C17H21ClN4O2S2 and a molecular weight of 412.97 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[4-(2-sulfanylidene-1,3-thiazolidine-4-carbonyl)-1,4-diazepan-1-yl]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[4-(2-sulfanylidene-1,3-thiazolidine-4-carbonyl)-1,4-diazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 3727397 |
| Molecular Formula | C17H21ClN4O2S2 |
| Molecular Weight | 412.97 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | N-(2-chlorophenyl)-2-[4-(2-sulfanylidene-1,3-thiazolidine-4-carbonyl)-1,4-diazepan-1-yl]acetamide |
| SMILES | O=C(CN1CCCN(C(=O)C2CSC(=S)N2)CC1)Nc1ccccc1Cl |
| InChI | InChI=1S/C17H21ClN4O2S2/c18-12-4-1-2-5-13(12)19-15(23)10-21-6-3-7-22(9-8-21)16(24)14-11-26-17(25)20-14/h1-2,4-5,14H,3,6-11H2,(H,19,23)(H,20,25) |
| InChIKey | XCYWAIACPQZFJD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.97 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|