C17H25NO3S — CID 3727519
3-butyl-2-(3-ethoxy-4-methoxyphenyl)-1,3-thiazinan-4-one (PubChem CID 3727519) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is 3-butyl-2-(3-ethoxy-4-methoxyphenyl)-1,3-thiazinan-4-one.
| Compound Name | 3-butyl-2-(3-ethoxy-4-methoxyphenyl)-1,3-thiazinan-4-one |
|---|---|
| PubChem CID | 3727519 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 3-butyl-2-(3-ethoxy-4-methoxyphenyl)-1,3-thiazinan-4-one |
| SMILES | CCCCN1C(=O)CCSC1c1ccc(OC)c(OCC)c1 |
| InChI | InChI=1S/C17H25NO3S/c1-4-6-10-18-16(19)9-11-22-17(18)13-7-8-14(20-3)15(12-13)21-5-2/h7-8,12,17H,4-6,9-11H2,1-3H3 |
| InChIKey | RPRLETSOUPZJJU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |