C14H18ClNOS — CID 3749093
3-butyl-2-(4-chlorophenyl)-1,3-thiazinan-4-one (PubChem CID 3749093) has the molecular formula C14H18ClNOS and a molecular weight of 283.82 g/mol. Its IUPAC name is 3-butyl-2-(4-chlorophenyl)-1,3-thiazinan-4-one.
| Compound Name | 3-butyl-2-(4-chlorophenyl)-1,3-thiazinan-4-one |
|---|---|
| PubChem CID | 3749093 |
| Molecular Formula | C14H18ClNOS |
| Molecular Weight | 283.82 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 3-butyl-2-(4-chlorophenyl)-1,3-thiazinan-4-one |
| SMILES | CCCCN1C(=O)CCSC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H18ClNOS/c1-2-3-9-16-13(17)8-10-18-14(16)11-4-6-12(15)7-5-11/h4-7,14H,2-3,8-10H2,1H3 |
| InChIKey | WPXWFQLYBNTEOW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.82 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |