C10H19NO3S — CID 3738981
2-butyl-3-(2,3-dihydroxypropyl)-1,3-thiazolidin-4-one (PubChem CID 3738981) has the molecular formula C10H19NO3S and a molecular weight of 233.33 g/mol. Its IUPAC name is 2-butyl-3-(2,3-dihydroxypropyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-butyl-3-(2,3-dihydroxypropyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3738981 |
| Molecular Formula | C10H19NO3S |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 2-butyl-3-(2,3-dihydroxypropyl)-1,3-thiazolidin-4-one |
| SMILES | CCCCC1SCC(=O)N1CC(O)CO |
| InChI | InChI=1S/C10H19NO3S/c1-2-3-4-10-11(5-8(13)6-12)9(14)7-15-10/h8,10,12-13H,2-7H2,1H3 |
| InChIKey | BVRPBAYGSINIHQ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |