C24H26FN3O2S2 — CID 37399748
N-[4-[4-[[5-(3-fluorophenyl)thiophen-2-yl]methyl]piperazin-1-yl]-4-oxobutyl]thiophene-3-carboxamide (PubChem CID 37399748) has the molecular formula C24H26FN3O2S2 and a molecular weight of 471.62 g/mol. Its IUPAC name is N-[4-[4-[[5-(3-fluorophenyl)thiophen-2-yl]methyl]piperazin-1-yl]-4-oxobutyl]thiophene-3-carboxamide.
| Compound Name | N-[4-[4-[[5-(3-fluorophenyl)thiophen-2-yl]methyl]piperazin-1-yl]-4-oxobutyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 37399748 |
| Molecular Formula | C24H26FN3O2S2 |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | N-[4-[4-[[5-(3-fluorophenyl)thiophen-2-yl]methyl]piperazin-1-yl]-4-oxobutyl]thiophene-3-carboxamide |
| SMILES | O=C(NCCCC(=O)N1CCN(Cc2ccc(-c3cccc(F)c3)s2)CC1)c1ccsc1 |
| InChI | InChI=1S/C24H26FN3O2S2/c25-20-4-1-3-18(15-20)22-7-6-21(32-22)16-27-10-12-28(13-11-27)23(29)5-2-9-26-24(30)19-8-14-31-17-19/h1,3-4,6-8,14-15,17H,2,5,9-13,16H2,(H,26,30) |
| InChIKey | ZQWZTWNBZOPHBD-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|