C28H32N2O3 — CID 3745783
methyl 4-[4-carbamoyl-1-(2,3-dihydro-1H-inden-1-yl)-5-methyl-2-pentylpyrrol-3-yl]benzoate (PubChem CID 3745783) has the molecular formula C28H32N2O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is methyl 4-[4-carbamoyl-1-(2,3-dihydro-1H-inden-1-yl)-5-methyl-2-pentylpyrrol-3-yl]benzoate.
| Compound Name | methyl 4-[4-carbamoyl-1-(2,3-dihydro-1H-inden-1-yl)-5-methyl-2-pentylpyrrol-3-yl]benzoate |
|---|---|
| PubChem CID | 3745783 |
| Molecular Formula | C28H32N2O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | methyl 4-[4-carbamoyl-1-(2,3-dihydro-1H-inden-1-yl)-5-methyl-2-pentylpyrrol-3-yl]benzoate |
| SMILES | CCCCCc1c(-c2ccc(C(=O)OC)cc2)c(C(N)=O)c(C)n1C1CCc2ccccc21 |
| InChI | InChI=1S/C28H32N2O3/c1-4-5-6-11-24-26(20-12-14-21(15-13-20)28(32)33-3)25(27(29)31)18(2)30(24)23-17-16-19-9-7-8-10-22(19)23/h7-10,12-15,23H,4-6,11,16-17H2,1-3H3,(H2,29,31) |
| InChIKey | LKCBYZXRLZGGHR-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|