C25H36N2O — CID 3870481
1-cyclooctyl-2-methyl-5-pentyl-4-phenylpyrrole-3-carboxamide (PubChem CID 3870481) has the molecular formula C25H36N2O and a molecular weight of 380.58 g/mol. Its IUPAC name is 1-cyclooctyl-2-methyl-5-pentyl-4-phenylpyrrole-3-carboxamide.
| Compound Name | 1-cyclooctyl-2-methyl-5-pentyl-4-phenylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3870481 |
| Molecular Formula | C25H36N2O |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | 1-cyclooctyl-2-methyl-5-pentyl-4-phenylpyrrole-3-carboxamide |
| SMILES | CCCCCc1c(-c2ccccc2)c(C(N)=O)c(C)n1C1CCCCCCC1 |
| InChI | InChI=1S/C25H36N2O/c1-3-4-9-18-22-24(20-14-10-8-11-15-20)23(25(26)28)19(2)27(22)21-16-12-6-5-7-13-17-21/h8,10-11,14-15,21H,3-7,9,12-13,16-18H2,1-2H3,(H2,26,28) |
| InChIKey | PGSAXSFAEHLTBD-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|