C13H15ClN2O2S — CID 3753855
N-(3-chlorophenyl)-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxamide (PubChem CID 3753855) has the molecular formula C13H15ClN2O2S and a molecular weight of 298.80 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(3-chlorophenyl)-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 3753855 |
| Molecular Formula | C13H15ClN2O2S |
| Molecular Weight | 298.80 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | N-(3-chlorophenyl)-3-formyl-2,2-dimethyl-1,3-thiazolidine-4-carboxamide |
| SMILES | CC1(C)SCC(C(=O)Nc2cccc(Cl)c2)N1C=O |
| InChI | InChI=1S/C13H15ClN2O2S/c1-13(2)16(8-17)11(7-19-13)12(18)15-10-5-3-4-9(14)6-10/h3-6,8,11H,7H2,1-2H3,(H,15,18) |
| InChIKey | ABHYROHILFXCKT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.80 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|