C27H25N7O — CID 3757096
2-amino-N-(4-phenylbutan-2-yl)-1-(pyridin-3-ylmethylideneamino)pyrrolo[3,2-b]quinoxaline-3-carboxamide (PubChem CID 3757096) has the molecular formula C27H25N7O and a molecular weight of 463.55 g/mol. Its IUPAC name is 2-amino-N-(4-phenylbutan-2-yl)-1-(pyridin-3-ylmethylideneamino)pyrrolo[3,2-b]quinoxaline-3-carboxamide.
| Compound Name | 2-amino-N-(4-phenylbutan-2-yl)-1-(pyridin-3-ylmethylideneamino)pyrrolo[3,2-b]quinoxaline-3-carboxamide |
|---|---|
| PubChem CID | 3757096 |
| Molecular Formula | C27H25N7O |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 2-amino-N-(4-phenylbutan-2-yl)-1-(pyridin-3-ylmethylideneamino)pyrrolo[3,2-b]quinoxaline-3-carboxamide |
| SMILES | CC(CCc1ccccc1)NC(=O)c1c(N)n(N=Cc2cccnc2)c2nc3ccccc3nc12 |
| InChI | InChI=1S/C27H25N7O/c1-18(13-14-19-8-3-2-4-9-19)31-27(35)23-24-26(33-22-12-6-5-11-21(22)32-24)34(25(23)28)30-17-20-10-7-15-29-16-20/h2-12,15-18H,13-14,28H2,1H3,(H,31,35) |
| InChIKey | LSWLYMQUSCDGHA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 111.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|