C11H16F3NO4 — CID 3762735
ethyl 3-hydroxy-3-(trifluoromethyl)-2,3a,4,5,6,7-hexahydro-[1,2]oxazolo[2,3-a]pyridine-2-carboxylate (PubChem CID 3762735) has the molecular formula C11H16F3NO4 and a molecular weight of 283.25 g/mol. Its IUPAC name is ethyl 3-hydroxy-3-(trifluoromethyl)-2,3a,4,5,6,7-hexahydro-[1,2]oxazolo[2,3-a]pyridine-2-carboxylate.
| Compound Name | ethyl 3-hydroxy-3-(trifluoromethyl)-2,3a,4,5,6,7-hexahydro-[1,2]oxazolo[2,3-a]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 3762735 |
| Molecular Formula | C11H16F3NO4 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | ethyl 3-hydroxy-3-(trifluoromethyl)-2,3a,4,5,6,7-hexahydro-[1,2]oxazolo[2,3-a]pyridine-2-carboxylate |
| SMILES | CCOC(=O)C1ON2CCCCC2C1(O)C(F)(F)F |
| InChI | InChI=1S/C11H16F3NO4/c1-2-18-9(16)8-10(17,11(12,13)14)7-5-3-4-6-15(7)19-8/h7-8,17H,2-6H2,1H3 |
| InChIKey | RPWHQXMROMNIFP-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |