C23H21Cl2N3O4 — CID 3763317
N-[[3-chloro-4-[3-(2-chlorophenoxy)propoxy]-5-methoxyphenyl]methylideneamino]pyridine-4-carboxamide (PubChem CID 3763317) has the molecular formula C23H21Cl2N3O4 and a molecular weight of 474.34 g/mol. Its IUPAC name is N-[[3-chloro-4-[3-(2-chlorophenoxy)propoxy]-5-methoxyphenyl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[[3-chloro-4-[3-(2-chlorophenoxy)propoxy]-5-methoxyphenyl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 3763317 |
| Molecular Formula | C23H21Cl2N3O4 |
| Molecular Weight | 474.34 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | N-[[3-chloro-4-[3-(2-chlorophenoxy)propoxy]-5-methoxyphenyl]methylideneamino]pyridine-4-carboxamide |
| SMILES | COc1cc(C=NNC(=O)c2ccncc2)cc(Cl)c1OCCCOc1ccccc1Cl |
| InChI | InChI=1S/C23H21Cl2N3O4/c1-30-21-14-16(15-27-28-23(29)17-7-9-26-10-8-17)13-19(25)22(21)32-12-4-11-31-20-6-3-2-5-18(20)24/h2-3,5-10,13-15H,4,11-12H2,1H3,(H,28,29) |
| InChIKey | KEHAINKNKUFFHU-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.34 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|