C6H9FN4O — CID 3776070
2-[(2-amino-6-fluoropyrimidin-4-yl)amino]ethanol (PubChem CID 3776070) has the molecular formula C6H9FN4O and a molecular weight of 172.16 g/mol. Its IUPAC name is 2-[(2-amino-6-fluoropyrimidin-4-yl)amino]ethanol.
| Compound Name | 2-[(2-amino-6-fluoropyrimidin-4-yl)amino]ethanol |
|---|---|
| PubChem CID | 3776070 |
| Molecular Formula | C6H9FN4O |
| Molecular Weight | 172.16 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 2-[(2-amino-6-fluoropyrimidin-4-yl)amino]ethanol |
| SMILES | Nc1nc(F)cc(NCCO)n1 |
| InChI | InChI=1S/C6H9FN4O/c7-4-3-5(9-1-2-12)11-6(8)10-4/h3,12H,1-2H2,(H3,8,9,10,11) |
| InChIKey | JKFRRQYLWXFBHR-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.16 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |