C19H21NO2 — CID 3777386
3,11b-dimethyl-2,3,4,6,7,12-hexahydroisoquinolino[2,1-a]quinoline-1,13-dione (PubChem CID 3777386) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is 3,11b-dimethyl-2,3,4,6,7,12-hexahydroisoquinolino[2,1-a]quinoline-1,13-dione.
| Compound Name | 3,11b-dimethyl-2,3,4,6,7,12-hexahydroisoquinolino[2,1-a]quinoline-1,13-dione |
|---|---|
| PubChem CID | 3777386 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 3,11b-dimethyl-2,3,4,6,7,12-hexahydroisoquinolino[2,1-a]quinoline-1,13-dione |
| SMILES | CC1CC(=O)C2=C(C1)N1CCc3ccccc3C1(C)CC2=O |
| InChI | InChI=1S/C19H21NO2/c1-12-9-15-18(16(21)10-12)17(22)11-19(2)14-6-4-3-5-13(14)7-8-20(15)19/h3-6,12H,7-11H2,1-2H3 |
| InChIKey | LIJVPONAUFDLFP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|