C17H17NO2S — CID 7304017
(10R)-10-methyl-4-thia-1-azatetracyclo[8.8.0.02,7.011,16]octadeca-2(7),11,13,15-tetraene-6,8-dione (PubChem CID 7304017) has the molecular formula C17H17NO2S and a molecular weight of 299.40 g/mol. Its IUPAC name is (10R)-10-methyl-4-thia-1-azatetracyclo[8.8.0.02,7.011,16]octadeca-2(7),11,13,15-tetraene-6,8-dione.
| Compound Name | (10R)-10-methyl-4-thia-1-azatetracyclo[8.8.0.02,7.011,16]octadeca-2(7),11,13,15-tetraene-6,8-dione |
|---|---|
| PubChem CID | 7304017 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | (10R)-10-methyl-4-thia-1-azatetracyclo[8.8.0.02,7.011,16]octadeca-2(7),11,13,15-tetraene-6,8-dione |
| SMILES | C[C@]12CC(=O)C3=C(CSCC3=O)N1CCc1ccccc12 |
| InChI | InChI=1S/C17H17NO2S/c1-17-8-14(19)16-13(9-21-10-15(16)20)18(17)7-6-11-4-2-3-5-12(11)17/h2-5H,6-10H2,1H3/t17-/m1/s1 |
| InChIKey | MREYRTWMEALSJJ-QGZVFWFLSA-N |
| XLogP | 2.30 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|