C18H21BrN4O4 — CID 3787120
1-(1-adamantyl)-3-[(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]urea (PubChem CID 3787120) has the molecular formula C18H21BrN4O4 and a molecular weight of 437.29 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]urea.
| Compound Name | 1-(1-adamantyl)-3-[(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 3787120 |
| Molecular Formula | C18H21BrN4O4 |
| Molecular Weight | 437.29 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | 1-(1-adamantyl)-3-[(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]urea |
| SMILES | O=C(NN=Cc1cc(Br)cc([N+](=O)[O-])c1O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H21BrN4O4/c19-14-4-13(16(24)15(5-14)23(26)27)9-20-22-17(25)21-18-6-10-1-11(7-18)3-12(2-10)8-18/h4-5,9-12,24H,1-3,6-8H2,(H2,21,22,25) |
| InChIKey | GAKABOCVZXNUNO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 116.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.29 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|