C24H25NO — CID 3797697
N-(furan-2-ylmethyl)-4-methyl-N-(4-methyl-1-phenylpent-1-yn-3-yl)aniline (PubChem CID 3797697) has the molecular formula C24H25NO and a molecular weight of 343.47 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-methyl-N-(4-methyl-1-phenylpent-1-yn-3-yl)aniline.
| Compound Name | N-(furan-2-ylmethyl)-4-methyl-N-(4-methyl-1-phenylpent-1-yn-3-yl)aniline |
|---|---|
| PubChem CID | 3797697 |
| Molecular Formula | C24H25NO |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-methyl-N-(4-methyl-1-phenylpent-1-yn-3-yl)aniline |
| SMILES | Cc1ccc(N(Cc2ccco2)C(C#Cc2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C24H25NO/c1-19(2)24(16-13-21-8-5-4-6-9-21)25(18-23-10-7-17-26-23)22-14-11-20(3)12-15-22/h4-12,14-15,17,19,24H,18H2,1-3H3 |
| InChIKey | KXCDSZYPHQDBNN-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|