C20H22ClNO3S — CID 38004372
ethyl 4-[[(2R)-2-(4-chlorophenyl)sulfanylbutanoyl]amino]-3-methylbenzoate (PubChem CID 38004372) has the molecular formula C20H22ClNO3S and a molecular weight of 391.92 g/mol. Its IUPAC name is ethyl 4-[[(2R)-2-(4-chlorophenyl)sulfanylbutanoyl]amino]-3-methylbenzoate.
| Compound Name | ethyl 4-[[(2R)-2-(4-chlorophenyl)sulfanylbutanoyl]amino]-3-methylbenzoate |
|---|---|
| PubChem CID | 38004372 |
| Molecular Formula | C20H22ClNO3S |
| Molecular Weight | 391.92 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | ethyl 4-[[(2R)-2-(4-chlorophenyl)sulfanylbutanoyl]amino]-3-methylbenzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)[C@@H](CC)Sc2ccc(Cl)cc2)c(C)c1 |
| InChI | InChI=1S/C20H22ClNO3S/c1-4-18(26-16-9-7-15(21)8-10-16)19(23)22-17-11-6-14(12-13(17)3)20(24)25-5-2/h6-12,18H,4-5H2,1-3H3,(H,22,23)/t18-/m1/s1 |
| InChIKey | YQYHXNLJBCDPEZ-GOSISDBHSA-N |
| XLogP | 5.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.92 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |