C26H26N8OS — CID 38020847
6-[(2,5-dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-yl)sulfanylmethyl]-2-N-(4-ethoxyphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 38020847) has the molecular formula C26H26N8OS and a molecular weight of 498.62 g/mol. Its IUPAC name is 6-[(2,5-dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-yl)sulfanylmethyl]-2-N-(4-ethoxyphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(2,5-dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-yl)sulfanylmethyl]-2-N-(4-ethoxyphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 38020847 |
| Molecular Formula | C26H26N8OS |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 6-[(2,5-dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-yl)sulfanylmethyl]-2-N-(4-ethoxyphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCOc1ccc(Nc2nc(N)nc(CSc3cc(C)nc4c(-c5ccccc5)c(C)nn34)n2)cc1 |
| InChI | InChI=1S/C26H26N8OS/c1-4-35-20-12-10-19(11-13-20)29-26-31-21(30-25(27)32-26)15-36-22-14-16(2)28-24-23(17(3)33-34(22)24)18-8-6-5-7-9-18/h5-14H,4,15H2,1-3H3,(H3,27,29,30,31,32) |
| InChIKey | FWRPZXFQKAZLRH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |