C17H32NO2+ — CID 3803696
4-methyl-4-[2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]ethyl]morpholin-4-ium (PubChem CID 3803696) has the molecular formula C17H32NO2+ and a molecular weight of 282.45 g/mol. Its IUPAC name is 4-methyl-4-[2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]ethyl]morpholin-4-ium.
| Compound Name | 4-methyl-4-[2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]ethyl]morpholin-4-ium |
|---|---|
| PubChem CID | 3803696 |
| Molecular Formula | C17H32NO2+ |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | 4-methyl-4-[2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]ethyl]morpholin-4-ium |
| SMILES | CC1(C)C2CCC1(C)C(OCC[N+]1(C)CCOCC1)C2 |
| InChI | InChI=1S/C17H32NO2/c1-16(2)14-5-6-17(16,3)15(13-14)20-12-9-18(4)7-10-19-11-8-18/h14-15H,5-13H2,1-4H3/q+1 |
| InChIKey | ICGYXPYGYBAYQN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|