C12H15ClN4OS — CID 3806773
1-[[(4-chlorophenyl)methoxyamino]methylidene]-3-(dimethylaminomethylidene)thiourea (PubChem CID 3806773) has the molecular formula C12H15ClN4OS and a molecular weight of 298.80 g/mol. Its IUPAC name is 1-[[(4-chlorophenyl)methoxyamino]methylidene]-3-(dimethylaminomethylidene)thiourea.
| Compound Name | 1-[[(4-chlorophenyl)methoxyamino]methylidene]-3-(dimethylaminomethylidene)thiourea |
|---|---|
| PubChem CID | 3806773 |
| Molecular Formula | C12H15ClN4OS |
| Molecular Weight | 298.80 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 1-[[(4-chlorophenyl)methoxyamino]methylidene]-3-(dimethylaminomethylidene)thiourea |
| SMILES | CN(C)C=NC(=S)N=CNOCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H15ClN4OS/c1-17(2)9-15-12(19)14-8-16-18-7-10-3-5-11(13)6-4-10/h3-6,8-9H,7H2,1-2H3,(H,14,16,19) |
| InChIKey | ZCZINBRGLRSRSF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.80 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|