C23H30N8O5 — CID 3809761
N-(2-amino-2-oxoethyl)-1-[6-[4-(2-ethoxyphenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]pyrrolidine-2-carboxamide (PubChem CID 3809761) has the molecular formula C23H30N8O5 and a molecular weight of 498.54 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-1-[6-[4-(2-ethoxyphenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]pyrrolidine-2-carboxamide.
| Compound Name | N-(2-amino-2-oxoethyl)-1-[6-[4-(2-ethoxyphenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 3809761 |
| Molecular Formula | C23H30N8O5 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-1-[6-[4-(2-ethoxyphenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]pyrrolidine-2-carboxamide |
| SMILES | CCOc1ccccc1N1CCN(c2ncnc(N3CCCC3C(=O)NCC(N)=O)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C23H30N8O5/c1-2-36-18-8-4-3-6-16(18)28-10-12-29(13-11-28)21-20(31(34)35)22(27-15-26-21)30-9-5-7-17(30)23(33)25-14-19(24)32/h3-4,6,8,15,17H,2,5,7,9-14H2,1H3,(H2,24,32)(H,25,33) |
| InChIKey | SCBHVGBEBUBMLN-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 160.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|