C18H19BrFN7O4 — CID 3840242
N-(2-amino-2-oxoethyl)-1-[6-[(3-bromo-4-fluorophenyl)methylamino]-5-nitropyrimidin-4-yl]pyrrolidine-2-carboxamide (PubChem CID 3840242) has the molecular formula C18H19BrFN7O4 and a molecular weight of 496.30 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-1-[6-[(3-bromo-4-fluorophenyl)methylamino]-5-nitropyrimidin-4-yl]pyrrolidine-2-carboxamide.
| Compound Name | N-(2-amino-2-oxoethyl)-1-[6-[(3-bromo-4-fluorophenyl)methylamino]-5-nitropyrimidin-4-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 3840242 |
| Molecular Formula | C18H19BrFN7O4 |
| Molecular Weight | 496.30 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-1-[6-[(3-bromo-4-fluorophenyl)methylamino]-5-nitropyrimidin-4-yl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)CNC(=O)C1CCCN1c1ncnc(NCc2ccc(F)c(Br)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19BrFN7O4/c19-11-6-10(3-4-12(11)20)7-22-16-15(27(30)31)17(25-9-24-16)26-5-1-2-13(26)18(29)23-8-14(21)28/h3-4,6,9,13H,1-2,5,7-8H2,(H2,21,28)(H,23,29)(H,22,24,25) |
| InChIKey | ROONLQTXYTUYAE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 156.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|