C21H26FN7O4 — CID 3859374
N-(2-amino-2-oxoethyl)-1-[6-[[1-(4-fluorophenyl)-2-methylpropan-2-yl]amino]-5-nitropyrimidin-4-yl]pyrrolidine-2-carboxamide (PubChem CID 3859374) has the molecular formula C21H26FN7O4 and a molecular weight of 459.48 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-1-[6-[[1-(4-fluorophenyl)-2-methylpropan-2-yl]amino]-5-nitropyrimidin-4-yl]pyrrolidine-2-carboxamide.
| Compound Name | N-(2-amino-2-oxoethyl)-1-[6-[[1-(4-fluorophenyl)-2-methylpropan-2-yl]amino]-5-nitropyrimidin-4-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 3859374 |
| Molecular Formula | C21H26FN7O4 |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-1-[6-[[1-(4-fluorophenyl)-2-methylpropan-2-yl]amino]-5-nitropyrimidin-4-yl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)(Cc1ccc(F)cc1)Nc1ncnc(N2CCCC2C(=O)NCC(N)=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H26FN7O4/c1-21(2,10-13-5-7-14(22)8-6-13)27-18-17(29(32)33)19(26-12-25-18)28-9-3-4-15(28)20(31)24-11-16(23)30/h5-8,12,15H,3-4,9-11H2,1-2H3,(H2,23,30)(H,24,31)(H,25,26,27) |
| InChIKey | UROQLGMLWKLQIH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 156.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|