C17H16ClFN6O5 — CID 3727977
N-(2-amino-2-oxoethyl)-1-[6-(4-chloro-2-fluorophenoxy)-5-nitropyrimidin-4-yl]pyrrolidine-2-carboxamide (PubChem CID 3727977) has the molecular formula C17H16ClFN6O5 and a molecular weight of 438.80 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-1-[6-(4-chloro-2-fluorophenoxy)-5-nitropyrimidin-4-yl]pyrrolidine-2-carboxamide.
| Compound Name | N-(2-amino-2-oxoethyl)-1-[6-(4-chloro-2-fluorophenoxy)-5-nitropyrimidin-4-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 3727977 |
| Molecular Formula | C17H16ClFN6O5 |
| Molecular Weight | 438.80 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-1-[6-(4-chloro-2-fluorophenoxy)-5-nitropyrimidin-4-yl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)CNC(=O)C1CCCN1c1ncnc(Oc2ccc(Cl)cc2F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16ClFN6O5/c18-9-3-4-12(10(19)6-9)30-17-14(25(28)29)15(22-8-23-17)24-5-1-2-11(24)16(27)21-7-13(20)26/h3-4,6,8,11H,1-2,5,7H2,(H2,20,26)(H,21,27) |
| InChIKey | OASAOSLMSIUSGS-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 153.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.80 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|