C27H22BrClN2O3 — CID 3819897
N-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-naphthalen-1-ylacetamide (PubChem CID 3819897) has the molecular formula C27H22BrClN2O3 and a molecular weight of 537.84 g/mol. Its IUPAC name is N-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 3819897 |
| Molecular Formula | C27H22BrClN2O3 |
| Molecular Weight | 537.84 g/mol |
| Exact Mass | 536.05 |
| IUPAC Name | N-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-naphthalen-1-ylacetamide |
| SMILES | COc1cc(C=NNC(=O)Cc2cccc3ccccc23)c(Br)cc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H22BrClN2O3/c1-33-25-13-21(24(28)15-26(25)34-17-18-9-11-22(29)12-10-18)16-30-31-27(32)14-20-7-4-6-19-5-2-3-8-23(19)20/h2-13,15-16H,14,17H2,1H3,(H,31,32) |
| InChIKey | WIUOUTUDAGZMOV-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.84 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|