C18H17NO4S — CID 3820975
methyl 3-[4-(2,3-dihydroindol-1-yl)-3,6-dioxocyclohexa-1,4-dien-1-yl]sulfanylpropanoate (PubChem CID 3820975) has the molecular formula C18H17NO4S and a molecular weight of 343.40 g/mol. Its IUPAC name is methyl 3-[4-(2,3-dihydroindol-1-yl)-3,6-dioxocyclohexa-1,4-dien-1-yl]sulfanylpropanoate.
| Compound Name | methyl 3-[4-(2,3-dihydroindol-1-yl)-3,6-dioxocyclohexa-1,4-dien-1-yl]sulfanylpropanoate |
|---|---|
| PubChem CID | 3820975 |
| Molecular Formula | C18H17NO4S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | methyl 3-[4-(2,3-dihydroindol-1-yl)-3,6-dioxocyclohexa-1,4-dien-1-yl]sulfanylpropanoate |
| SMILES | COC(=O)CCSC1=CC(=O)C(N2CCc3ccccc32)=CC1=O |
| InChI | InChI=1S/C18H17NO4S/c1-23-18(22)7-9-24-17-11-15(20)14(10-16(17)21)19-8-6-12-4-2-3-5-13(12)19/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | DSXRPEQIRLVJEB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|