C19H20Cl3NO4S — CID 3821433
3-(4-chlorophenyl)sulfanyl-N-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-2-hydroxy-2-methylpropanamide (PubChem CID 3821433) has the molecular formula C19H20Cl3NO4S and a molecular weight of 464.80 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfanyl-N-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-2-hydroxy-2-methylpropanamide.
| Compound Name | 3-(4-chlorophenyl)sulfanyl-N-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-2-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 3821433 |
| Molecular Formula | C19H20Cl3NO4S |
| Molecular Weight | 464.80 g/mol |
| Exact Mass | 463.02 |
| IUPAC Name | 3-(4-chlorophenyl)sulfanyl-N-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-2-hydroxy-2-methylpropanamide |
| SMILES | COCCOc1cc(NC(=O)C(C)(O)CSc2ccc(Cl)cc2)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H20Cl3NO4S/c1-19(25,11-28-13-5-3-12(20)4-6-13)18(24)23-16-10-17(27-8-7-26-2)15(22)9-14(16)21/h3-6,9-10,25H,7-8,11H2,1-2H3,(H,23,24) |
| InChIKey | ADCXIHFJAGIQDY-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.80 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|