C15H20Cl2N2O4S — CID 2765564
N-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-2-[2-(dimethylamino)-2-oxoethyl]sulfanylacetamide (PubChem CID 2765564) has the molecular formula C15H20Cl2N2O4S and a molecular weight of 395.31 g/mol. Its IUPAC name is N-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-2-[2-(dimethylamino)-2-oxoethyl]sulfanylacetamide.
| Compound Name | N-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-2-[2-(dimethylamino)-2-oxoethyl]sulfanylacetamide |
|---|---|
| PubChem CID | 2765564 |
| Molecular Formula | C15H20Cl2N2O4S |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | N-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-2-[2-(dimethylamino)-2-oxoethyl]sulfanylacetamide |
| SMILES | COCCOc1cc(NC(=O)CSCC(=O)N(C)C)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H20Cl2N2O4S/c1-19(2)15(21)9-24-8-14(20)18-12-7-13(23-5-4-22-3)11(17)6-10(12)16/h6-7H,4-5,8-9H2,1-3H3,(H,18,20) |
| InChIKey | NISMGJWMATYVQX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|