C30H46N2O5 — CID 3823558
2-[1-[13-[1-(6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene)ethyl]-1,4,10-trioxa-7,13-diazacyclopentadec-7-yl]ethylidene]-6,6-dimethylbicyclo[3.1.0]hexan-3-one (PubChem CID 3823558) has the molecular formula C30H46N2O5 and a molecular weight of 514.71 g/mol. Its IUPAC name is 2-[1-[13-[1-(6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene)ethyl]-1,4,10-trioxa-7,13-diazacyclopentadec-7-yl]ethylidene]-6,6-dimethylbicyclo[3.1.0]hexan-3-one.
| Compound Name | 2-[1-[13-[1-(6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene)ethyl]-1,4,10-trioxa-7,13-diazacyclopentadec-7-yl]ethylidene]-6,6-dimethylbicyclo[3.1.0]hexan-3-one |
|---|---|
| PubChem CID | 3823558 |
| Molecular Formula | C30H46N2O5 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.34 |
| IUPAC Name | 2-[1-[13-[1-(6,6-dimethyl-3-oxo-2-bicyclo[3.1.0]hexanylidene)ethyl]-1,4,10-trioxa-7,13-diazacyclopentadec-7-yl]ethylidene]-6,6-dimethylbicyclo[3.1.0]hexan-3-one |
| SMILES | CC(=C1C(=O)CC2C1C2(C)C)N1CCOCCOCCN(C(C)=C2C(=O)CC3C2C3(C)C)CCOCC1 |
| InChI | InChI=1S/C30H46N2O5/c1-19(25-23(33)17-21-27(25)29(21,3)4)31-7-11-35-12-8-32(10-14-37-16-15-36-13-9-31)20(2)26-24(34)18-22-28(26)30(22,5)6/h21-22,27-28H,7-18H2,1-6H3 |
| InChIKey | DJFXXLPKTNJYMC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|