C17H28N2O2 — CID 7068319
(1R,5R)-6,6-dimethyl-2-[C-methyl-N-(3-morpholin-4-ylpropyl)carbonimidoyl]bicyclo[3.1.0]hexan-3-one (PubChem CID 7068319) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is (1R,5R)-6,6-dimethyl-2-[C-methyl-N-(3-morpholin-4-ylpropyl)carbonimidoyl]bicyclo[3.1.0]hexan-3-one.
| Compound Name | (1R,5R)-6,6-dimethyl-2-[C-methyl-N-(3-morpholin-4-ylpropyl)carbonimidoyl]bicyclo[3.1.0]hexan-3-one |
|---|---|
| PubChem CID | 7068319 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | (1R,5R)-6,6-dimethyl-2-[C-methyl-N-(3-morpholin-4-ylpropyl)carbonimidoyl]bicyclo[3.1.0]hexan-3-one |
| SMILES | C/C(=N\CCCN1CCOCC1)C1C(=O)C[C@@H]2[C@H]1C2(C)C |
| InChI | InChI=1S/C17H28N2O2/c1-12(15-14(20)11-13-16(15)17(13,2)3)18-5-4-6-19-7-9-21-10-8-19/h13,15-16H,4-11H2,1-3H3/b18-12+/t13-,15?,16-/m1/s1 |
| InChIKey | WULGJJKAXYHPII-USANKCGDSA-N |
| XLogP | 2.03 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|