C17H33NO3 — CID 3826581
(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) octanoate (PubChem CID 3826581) has the molecular formula C17H33NO3 and a molecular weight of 299.46 g/mol. Its IUPAC name is (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) octanoate.
| Compound Name | (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) octanoate |
|---|---|
| PubChem CID | 3826581 |
| Molecular Formula | C17H33NO3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.25 |
| IUPAC Name | (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) octanoate |
| SMILES | CCCCCCCC(=O)OC1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C17H33NO3/c1-6-7-8-9-10-11-15(19)21-14-12-16(2,3)18(20)17(4,5)13-14/h14,20H,6-13H2,1-5H3 |
| InChIKey | VZSCEEGBKGDYGI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|