C44H84N2O6 — CID 3592789
bis(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl) decanedioate (PubChem CID 3592789) has the molecular formula C44H84N2O6 and a molecular weight of 737.16 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl) decanedioate.
| Compound Name | bis(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl) decanedioate |
|---|---|
| PubChem CID | 3592789 |
| Molecular Formula | C44H84N2O6 |
| Molecular Weight | 737.16 g/mol |
| Exact Mass | 736.63 |
| IUPAC Name | bis(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl) decanedioate |
| SMILES | CCCCCCCCON1C(C)(C)CC(OC(=O)CCCCCCCCC(=O)OC2CC(C)(C)N(OCCCCCCCC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C44H84N2O6/c1-11-13-15-17-23-27-31-49-45-41(3,4)33-37(34-42(45,5)6)51-39(47)29-25-21-19-20-22-26-30-40(48)52-38-35-43(7,8)46(44(9,10)36-38)50-32-28-24-18-16-14-12-2/h37-38H,11-36H2,1-10H3 |
| InChIKey | OSIVCXJNIBEGCL-UHFFFAOYSA-N |
| XLogP | 11.82 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.16 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|