C28H52N2O6 — CID 11272241
bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) decanedioate (PubChem CID 11272241) has the molecular formula C28H52N2O6 and a molecular weight of 512.73 g/mol. Its IUPAC name is bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) decanedioate.
| Compound Name | bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) decanedioate |
|---|---|
| PubChem CID | 11272241 |
| Molecular Formula | C28H52N2O6 |
| Molecular Weight | 512.73 g/mol |
| Exact Mass | 512.38 |
| IUPAC Name | bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) decanedioate |
| SMILES | CC1(C)CC(OC(=O)CCCCCCCCC(=O)OC2CC(C)(C)N(O)C(C)(C)C2)CC(C)(C)N1O |
| InChI | InChI=1S/C28H52N2O6/c1-25(2)17-21(18-26(3,4)29(25)33)35-23(31)15-13-11-9-10-12-14-16-24(32)36-22-19-27(5,6)30(34)28(7,8)20-22/h21-22,33-34H,9-20H2,1-8H3 |
| InChIKey | SXPLGYBFGPYAHS-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.73 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|