C19H16F3N5O4S — CID 38273318
N-methyl-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitro-N-[[2-(trifluoromethoxy)phenyl]methyl]benzamide (PubChem CID 38273318) has the molecular formula C19H16F3N5O4S and a molecular weight of 467.43 g/mol. Its IUPAC name is N-methyl-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitro-N-[[2-(trifluoromethoxy)phenyl]methyl]benzamide.
| Compound Name | N-methyl-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitro-N-[[2-(trifluoromethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 38273318 |
| Molecular Formula | C19H16F3N5O4S |
| Molecular Weight | 467.43 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | N-methyl-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitro-N-[[2-(trifluoromethoxy)phenyl]methyl]benzamide |
| SMILES | CN(Cc1ccccc1OC(F)(F)F)C(=O)c1ccc(Sc2nncn2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H16F3N5O4S/c1-25(10-13-5-3-4-6-15(13)31-19(20,21)22)17(28)12-7-8-16(14(9-12)27(29)30)32-18-24-23-11-26(18)2/h3-9,11H,10H2,1-2H3 |
| InChIKey | OACXJSBSBJEOFD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 103.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|