C21H16FN5O3S2 — CID 60533844
N-(4-fluorophenyl)-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitro-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 60533844) has the molecular formula C21H16FN5O3S2 and a molecular weight of 469.52 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitro-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | N-(4-fluorophenyl)-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitro-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 60533844 |
| Molecular Formula | C21H16FN5O3S2 |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | N-(4-fluorophenyl)-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitro-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | Cn1cnnc1Sc1ccc(C(=O)N(Cc2cccs2)c2ccc(F)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H16FN5O3S2/c1-25-13-23-24-21(25)32-19-9-4-14(11-18(19)27(29)30)20(28)26(12-17-3-2-10-31-17)16-7-5-15(22)6-8-16/h2-11,13H,12H2,1H3 |
| InChIKey | CZSZRALTQUWCQV-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|