C20H15F2N3O8S2 — CID 3827402
N-(3,4-difluorophenyl)-4-methyl-N-(4-methyl-3-nitrophenyl)sulfonyl-3-nitrobenzenesulfonamide (PubChem CID 3827402) has the molecular formula C20H15F2N3O8S2 and a molecular weight of 527.48 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-4-methyl-N-(4-methyl-3-nitrophenyl)sulfonyl-3-nitrobenzenesulfonamide.
| Compound Name | N-(3,4-difluorophenyl)-4-methyl-N-(4-methyl-3-nitrophenyl)sulfonyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 3827402 |
| Molecular Formula | C20H15F2N3O8S2 |
| Molecular Weight | 527.48 g/mol |
| Exact Mass | 527.03 |
| IUPAC Name | N-(3,4-difluorophenyl)-4-methyl-N-(4-methyl-3-nitrophenyl)sulfonyl-3-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(c2ccc(F)c(F)c2)S(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H15F2N3O8S2/c1-12-3-6-15(10-19(12)23(26)27)34(30,31)25(14-5-8-17(21)18(22)9-14)35(32,33)16-7-4-13(2)20(11-16)24(28)29/h3-11H,1-2H3 |
| InChIKey | HXHFARWRJXTBJU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|