C17H9Cl2F6NO — CID 3830084
3-[3,5-bis(trifluoromethyl)anilino]-1-(2,4-dichlorophenyl)prop-2-en-1-one (PubChem CID 3830084) has the molecular formula C17H9Cl2F6NO and a molecular weight of 428.16 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)anilino]-1-(2,4-dichlorophenyl)prop-2-en-1-one.
| Compound Name | 3-[3,5-bis(trifluoromethyl)anilino]-1-(2,4-dichlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3830084 |
| Molecular Formula | C17H9Cl2F6NO |
| Molecular Weight | 428.16 g/mol |
| Exact Mass | 427.00 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)anilino]-1-(2,4-dichlorophenyl)prop-2-en-1-one |
| SMILES | O=C(C=CNc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H9Cl2F6NO/c18-11-1-2-13(14(19)8-11)15(27)3-4-26-12-6-9(16(20,21)22)5-10(7-12)17(23,24)25/h1-8,26H |
| InChIKey | CHZLDNRUXDPLCO-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.16 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|