C21H21F6N3O2 — CID 3830556
N-[3,5-bis(trifluoromethyl)phenyl]-4-(4-methoxyphenyl)-3-methylpiperazine-1-carboxamide (PubChem CID 3830556) has the molecular formula C21H21F6N3O2 and a molecular weight of 461.41 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-4-(4-methoxyphenyl)-3-methylpiperazine-1-carboxamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-(4-methoxyphenyl)-3-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 3830556 |
| Molecular Formula | C21H21F6N3O2 |
| Molecular Weight | 461.41 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-(4-methoxyphenyl)-3-methylpiperazine-1-carboxamide |
| SMILES | COc1ccc(N2CCN(C(=O)Nc3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC2C)cc1 |
| InChI | InChI=1S/C21H21F6N3O2/c1-13-12-29(7-8-30(13)17-3-5-18(32-2)6-4-17)19(31)28-16-10-14(20(22,23)24)9-15(11-16)21(25,26)27/h3-6,9-11,13H,7-8,12H2,1-2H3,(H,28,31) |
| InChIKey | SRIYOPUBGTWTEX-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.41 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|