C26H32O8 — CID 38352933
methyl (3R,4aR,4bR,10aR,10bR,12aS)-6-hydroxy-3,4b,7,7,10a,12a-hexamethyl-12-methylidene-1,4,5,8-tetraoxo-9,10,10b,11-tetrahydronaphtho[2,1-f]isochromene-4a-carboxylate (PubChem CID 38352933) has the molecular formula C26H32O8 and a molecular weight of 472.53 g/mol. Its IUPAC name is methyl (3R,4aR,4bR,10aR,10bR,12aS)-6-hydroxy-3,4b,7,7,10a,12a-hexamethyl-12-methylidene-1,4,5,8-tetraoxo-9,10,10b,11-tetrahydronaphtho[2,1-f]isochromene-4a-carboxylate.
| Compound Name | methyl (3R,4aR,4bR,10aR,10bR,12aS)-6-hydroxy-3,4b,7,7,10a,12a-hexamethyl-12-methylidene-1,4,5,8-tetraoxo-9,10,10b,11-tetrahydronaphtho[2,1-f]isochromene-4a-carboxylate |
|---|---|
| PubChem CID | 38352933 |
| Molecular Formula | C26H32O8 |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | methyl (3R,4aR,4bR,10aR,10bR,12aS)-6-hydroxy-3,4b,7,7,10a,12a-hexamethyl-12-methylidene-1,4,5,8-tetraoxo-9,10,10b,11-tetrahydronaphtho[2,1-f]isochromene-4a-carboxylate |
| SMILES | C=C1C[C@@H]2[C@@]3(C)CCC(=O)C(C)(C)C3=C(O)C(=O)[C@@]2(C)[C@]2(C(=O)OC)C(=O)[C@@H](C)OC(=O)[C@@]12C |
| InChI | InChI=1S/C26H32O8/c1-12-11-14-23(5)10-9-15(27)22(3,4)17(23)16(28)19(30)25(14,7)26(21(32)33-8)18(29)13(2)34-20(31)24(12,26)6/h13-14,28H,1,9-11H2,2-8H3/t13-,14-,23-,24-,25+,26+/m1/s1 |
| InChIKey | WDTCRLAUTPEYFK-JTUYPFQTSA-N |
| XLogP | 3.04 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|