C19H32N4O4S — CID 38355340
1-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-[(2S)-2-methyl-2-morpholin-4-ylbutyl]urea (PubChem CID 38355340) has the molecular formula C19H32N4O4S and a molecular weight of 412.56 g/mol. Its IUPAC name is 1-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-[(2S)-2-methyl-2-morpholin-4-ylbutyl]urea.
| Compound Name | 1-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-[(2S)-2-methyl-2-morpholin-4-ylbutyl]urea |
|---|---|
| PubChem CID | 38355340 |
| Molecular Formula | C19H32N4O4S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 1-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-[(2S)-2-methyl-2-morpholin-4-ylbutyl]urea |
| SMILES | CC[C@@](C)(CNC(=O)NCc1ccccc1S(=O)(=O)N(C)C)N1CCOCC1 |
| InChI | InChI=1S/C19H32N4O4S/c1-5-19(2,23-10-12-27-13-11-23)15-21-18(24)20-14-16-8-6-7-9-17(16)28(25,26)22(3)4/h6-9H,5,10-15H2,1-4H3,(H2,20,21,24)/t19-/m0/s1 |
| InChIKey | ZCTILYHASHHMSP-IBGZPJMESA-N |
| XLogP | 1.24 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |