C13H15BrF3NO3S — CID 3840038
1-[4-bromo-2-(trifluoromethoxy)phenyl]sulfonyl-2-methylpiperidine (PubChem CID 3840038) has the molecular formula C13H15BrF3NO3S and a molecular weight of 402.23 g/mol. Its IUPAC name is 1-[4-bromo-2-(trifluoromethoxy)phenyl]sulfonyl-2-methylpiperidine.
| Compound Name | 1-[4-bromo-2-(trifluoromethoxy)phenyl]sulfonyl-2-methylpiperidine |
|---|---|
| PubChem CID | 3840038 |
| Molecular Formula | C13H15BrF3NO3S |
| Molecular Weight | 402.23 g/mol |
| Exact Mass | 400.99 |
| IUPAC Name | 1-[4-bromo-2-(trifluoromethoxy)phenyl]sulfonyl-2-methylpiperidine |
| SMILES | CC1CCCCN1S(=O)(=O)c1ccc(Br)cc1OC(F)(F)F |
| InChI | InChI=1S/C13H15BrF3NO3S/c1-9-4-2-3-7-18(9)22(19,20)12-6-5-10(14)8-11(12)21-13(15,16)17/h5-6,8-9H,2-4,7H2,1H3 |
| InChIKey | YXFSPSNCMRLHJN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.23 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |