C24H41NO3 — CID 3842786
3-(3-hydroxyoct-1-enyl)-2-(7-oxo-7-pyrrolidin-1-ylheptyl)cyclopentan-1-one (PubChem CID 3842786) has the molecular formula C24H41NO3 and a molecular weight of 391.60 g/mol. Its IUPAC name is 3-(3-hydroxyoct-1-enyl)-2-(7-oxo-7-pyrrolidin-1-ylheptyl)cyclopentan-1-one.
| Compound Name | 3-(3-hydroxyoct-1-enyl)-2-(7-oxo-7-pyrrolidin-1-ylheptyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 3842786 |
| Molecular Formula | C24H41NO3 |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.31 |
| IUPAC Name | 3-(3-hydroxyoct-1-enyl)-2-(7-oxo-7-pyrrolidin-1-ylheptyl)cyclopentan-1-one |
| SMILES | CCCCCC(O)C=CC1CCC(=O)C1CCCCCCC(=O)N1CCCC1 |
| InChI | InChI=1S/C24H41NO3/c1-2-3-6-11-21(26)16-14-20-15-17-23(27)22(20)12-7-4-5-8-13-24(28)25-18-9-10-19-25/h14,16,20-22,26H,2-13,15,17-19H2,1H3 |
| InChIKey | WUYWPOIYJBGJTK-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|