C18H18FN3O4S — CID 38460261
3-(2-cyanoethylsulfamoyl)-N-[2-(2-fluorophenoxy)ethyl]benzamide (PubChem CID 38460261) has the molecular formula C18H18FN3O4S and a molecular weight of 391.42 g/mol. Its IUPAC name is 3-(2-cyanoethylsulfamoyl)-N-[2-(2-fluorophenoxy)ethyl]benzamide.
| Compound Name | 3-(2-cyanoethylsulfamoyl)-N-[2-(2-fluorophenoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 38460261 |
| Molecular Formula | C18H18FN3O4S |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 3-(2-cyanoethylsulfamoyl)-N-[2-(2-fluorophenoxy)ethyl]benzamide |
| SMILES | N#CCCNS(=O)(=O)c1cccc(C(=O)NCCOc2ccccc2F)c1 |
| InChI | InChI=1S/C18H18FN3O4S/c19-16-7-1-2-8-17(16)26-12-11-21-18(23)14-5-3-6-15(13-14)27(24,25)22-10-4-9-20/h1-3,5-8,13,22H,4,10-12H2,(H,21,23) |
| InChIKey | SZKGKRKYNWKNEZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|