C14H20N4O3 — CID 3854189
4-(2-piperidin-4-yl-1,3-oxazole-4-carbonyl)piperazine-1-carbaldehyde (PubChem CID 3854189) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is 4-(2-piperidin-4-yl-1,3-oxazole-4-carbonyl)piperazine-1-carbaldehyde.
| Compound Name | 4-(2-piperidin-4-yl-1,3-oxazole-4-carbonyl)piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 3854189 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 4-(2-piperidin-4-yl-1,3-oxazole-4-carbonyl)piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN(C(=O)c2coc(C3CCNCC3)n2)CC1 |
| InChI | InChI=1S/C14H20N4O3/c19-10-17-5-7-18(8-6-17)14(20)12-9-21-13(16-12)11-1-3-15-4-2-11/h9-11,15H,1-8H2 |
| InChIKey | RZRJAHJYKIZFIQ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|