C23H20N4O2 — CID 3859588
2-(2-aminophenyl)-N-[4-[(4-aminophenyl)methyl]phenyl]-1,3-oxazole-4-carboxamide (PubChem CID 3859588) has the molecular formula C23H20N4O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is 2-(2-aminophenyl)-N-[4-[(4-aminophenyl)methyl]phenyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(2-aminophenyl)-N-[4-[(4-aminophenyl)methyl]phenyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3859588 |
| Molecular Formula | C23H20N4O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 2-(2-aminophenyl)-N-[4-[(4-aminophenyl)methyl]phenyl]-1,3-oxazole-4-carboxamide |
| SMILES | Nc1ccc(Cc2ccc(NC(=O)c3coc(-c4ccccc4N)n3)cc2)cc1 |
| InChI | InChI=1S/C23H20N4O2/c24-17-9-5-15(6-10-17)13-16-7-11-18(12-8-16)26-22(28)21-14-29-23(27-21)19-3-1-2-4-20(19)25/h1-12,14H,13,24-25H2,(H,26,28) |
| InChIKey | KVUDYKJEFQNLAU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 107.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|