C20H26FNO4S — CID 3862864
N-(2,2-diethoxyethyl)-3-fluoro-N-(2-phenylethyl)benzenesulfonamide (PubChem CID 3862864) has the molecular formula C20H26FNO4S and a molecular weight of 395.50 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)-3-fluoro-N-(2-phenylethyl)benzenesulfonamide.
| Compound Name | N-(2,2-diethoxyethyl)-3-fluoro-N-(2-phenylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3862864 |
| Molecular Formula | C20H26FNO4S |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | N-(2,2-diethoxyethyl)-3-fluoro-N-(2-phenylethyl)benzenesulfonamide |
| SMILES | CCOC(CN(CCc1ccccc1)S(=O)(=O)c1cccc(F)c1)OCC |
| InChI | InChI=1S/C20H26FNO4S/c1-3-25-20(26-4-2)16-22(14-13-17-9-6-5-7-10-17)27(23,24)19-12-8-11-18(21)15-19/h5-12,15,20H,3-4,13-14,16H2,1-2H3 |
| InChIKey | BSAGUKUKNIBQFN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|