C25H30N4O4S2 — CID 3866280
1-[4-[1-[2-(4-methylphenyl)sulfonylethyl]imidazol-2-yl]piperidin-1-yl]-2-(1-thiophen-2-ylethylideneamino)oxyethanone (PubChem CID 3866280) has the molecular formula C25H30N4O4S2 and a molecular weight of 514.67 g/mol. Its IUPAC name is 1-[4-[1-[2-(4-methylphenyl)sulfonylethyl]imidazol-2-yl]piperidin-1-yl]-2-(1-thiophen-2-ylethylideneamino)oxyethanone.
| Compound Name | 1-[4-[1-[2-(4-methylphenyl)sulfonylethyl]imidazol-2-yl]piperidin-1-yl]-2-(1-thiophen-2-ylethylideneamino)oxyethanone |
|---|---|
| PubChem CID | 3866280 |
| Molecular Formula | C25H30N4O4S2 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | 1-[4-[1-[2-(4-methylphenyl)sulfonylethyl]imidazol-2-yl]piperidin-1-yl]-2-(1-thiophen-2-ylethylideneamino)oxyethanone |
| SMILES | CC(=NOCC(=O)N1CCC(c2nccn2CCS(=O)(=O)c2ccc(C)cc2)CC1)c1cccs1 |
| InChI | InChI=1S/C25H30N4O4S2/c1-19-5-7-22(8-6-19)35(31,32)17-15-29-14-11-26-25(29)21-9-12-28(13-10-21)24(30)18-33-27-20(2)23-4-3-16-34-23/h3-8,11,14,16,21H,9-10,12-13,15,17-18H2,1-2H3 |
| InChIKey | SBLSUHALXLFLGD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 93.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|