C25H26N4O6S — CID 3859504
1-[4-[1-[2-(4-methylphenyl)sulfonylethyl]imidazol-2-yl]piperidin-1-yl]-2-(4-nitrophenyl)ethane-1,2-dione (PubChem CID 3859504) has the molecular formula C25H26N4O6S and a molecular weight of 510.57 g/mol. Its IUPAC name is 1-[4-[1-[2-(4-methylphenyl)sulfonylethyl]imidazol-2-yl]piperidin-1-yl]-2-(4-nitrophenyl)ethane-1,2-dione.
| Compound Name | 1-[4-[1-[2-(4-methylphenyl)sulfonylethyl]imidazol-2-yl]piperidin-1-yl]-2-(4-nitrophenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 3859504 |
| Molecular Formula | C25H26N4O6S |
| Molecular Weight | 510.57 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | 1-[4-[1-[2-(4-methylphenyl)sulfonylethyl]imidazol-2-yl]piperidin-1-yl]-2-(4-nitrophenyl)ethane-1,2-dione |
| SMILES | Cc1ccc(S(=O)(=O)CCn2ccnc2C2CCN(C(=O)C(=O)c3ccc([N+](=O)[O-])cc3)CC2)cc1 |
| InChI | InChI=1S/C25H26N4O6S/c1-18-2-8-22(9-3-18)36(34,35)17-16-27-15-12-26-24(27)20-10-13-28(14-11-20)25(31)23(30)19-4-6-21(7-5-19)29(32)33/h2-9,12,15,20H,10-11,13-14,16-17H2,1H3 |
| InChIKey | VZWVTTDKPNWEJX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 132.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.57 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|