C19H16ClFN2O4 — CID 3868140
1-(3-chloro-4-fluorophenyl)-3-(3,4-dihydroxyphenyl)-5-propan-2-ylpyrazole-4-carboxylic acid (PubChem CID 3868140) has the molecular formula C19H16ClFN2O4 and a molecular weight of 390.80 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-(3,4-dihydroxyphenyl)-5-propan-2-ylpyrazole-4-carboxylic acid.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-(3,4-dihydroxyphenyl)-5-propan-2-ylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 3868140 |
| Molecular Formula | C19H16ClFN2O4 |
| Molecular Weight | 390.80 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-(3,4-dihydroxyphenyl)-5-propan-2-ylpyrazole-4-carboxylic acid |
| SMILES | CC(C)c1c(C(=O)O)c(-c2ccc(O)c(O)c2)nn1-c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C19H16ClFN2O4/c1-9(2)18-16(19(26)27)17(10-3-6-14(24)15(25)7-10)22-23(18)11-4-5-13(21)12(20)8-11/h3-9,24-25H,1-2H3,(H,26,27) |
| InChIKey | AWSFKDKGRIELKR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.80 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|